0M4: N-(4-chloro-3-fluorophenyl)-N'-[(3aS,6aS)-hexahydrocyclopenta[c]pyrrol-3a(1H)-ylmethyl]ethanediamide
0M4 is a Ligand Of Interest in 4DVW designated by the RCSB
| Best-fitted instance in this entry |
| Other instances in this entry |
Identifier | Ranking for goodness of fit | Ranking for geometry | Real space R factor | Real space correlation coefficient | RMSZ-bond-length | RMSZ-bond-angle | Outliers of bond length | Outliers of bond angle | Atomic clashes | Stereochemical errors | Model completeness | Average occupancy |
4DVW_0M4_A_512 | 73% | 40% | 0.126 | 0.954 | 1.1 | 1.29 | 2 | 4 | 1 | 0 | 100% | 1 |
4DVW_0M4_B_512 | 47% | 41% | 0.177 | 0.916 | 1.11 | 1.26 | 2 | 3 | 0 | 0 | 100% | 1 |