4B2
(4S)-4-[2,4-difluoro-5-(pyrimidin-5-yl)phenyl]-4-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine
Find entries where: 4B2
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (4S)-4-[2,4-difluoro-5-(pyrimidin-5-yl)phenyl]-4-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| Synonyms | LY2811376; BACE inhibitor |
| Identifiers | (4S)-4-[2,4-bis(fluoranyl)-5-pyrimidin-5-yl-phenyl]-4-methyl-5,6-dihydro-1,3-thiazin-2-amine |
| Formula | C15 H14 F2 N4 S |
| Molecular Weight | 320.36 |
| Type | NON-POLYMER |
| Isomeric SMILES | C[C@]1(CCSC(=N1)N)c2cc(c(cc2F)F)c3cncnc3 |
| InChI | InChI=1S/C15H14F2N4S/c1-15(2-3-22-14(18)21-15)11-4-10(12(16)5-13(11)17)9-6-19-8-20-7-9/h4-8H,2-3H2,1H3,(H2,18,21)/t15-/m0/s1 |
| InChIKey | MJQMRGWYPNIERM-HNNXBMFYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 36 |
| Chiral Atom Count | 1 |
| Bond Count | 38 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB13065 |
|---|---|
| Name | LY-2811376 |
| Groups | investigational |
| Description | LY2811376 has been used in trials studying the basic science of Alzheimer's Disease. |
| Synonyms | LY-2811376 |
| Categories | Sulfur Compounds |
| CAS number | 1194044-20-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2333941 |
| PubChem | 44251605 |
| ChEMBL | CHEMBL2333941 |
