Chemical Component Summary | |
|---|---|
| Name | Mavoglurant |
| Synonyms | methyl (3aR,4S,7aR)-4-hydroxy-4-[(3-methylphenyl)ethynyl]octahydro-1H-indole-1-carboxylate |
| Identifiers | methyl (3aR,4S,7aR)-4-[2-(3-methylphenyl)ethynyl]-4-oxidanyl-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| Formula | C19 H23 N O3 |
| Molecular Weight | 313.391 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1cccc(c1)C#C[C@@]2(CCC[C@@H]3[C@H]2CCN3C(=O)OC)O |
| InChI | InChI=1S/C19H23NO3/c1-14-5-3-6-15(13-14)8-11-19(22)10-4-7-17-16(19)9-12-20(17)18(21)23-2/h3,5-6,13,16-17,22H,4,7,9-10,12H2,1-2H3/t16-,17-,19-/m1/s1 |
| InChIKey | ZFPZEYHRWGMJCV-ZHALLVOQSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 46 |
| Chiral Atom Count | 3 |
| Bond Count | 48 |
| Aromatic Bond Count | 6 |
Drug Info: DrugBank
| DrugBank ID | DB13004 |
|---|---|
| Name | Mavoglurant |
| Groups | investigational |
| Description | Mavoglurant has been used in trials studying the treatment of Patient Diagnosed With OCD and and Resistant to SSRI Treatment (Failed SSRI Over 12 Weeks at Appropriate Doses). |
| Synonyms | Mavoglurant |
| Categories | Heterocyclic Compounds, Fused-Ring |
| CAS number | 543906-09-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3087515 |
| PubChem | 9926832 |
| ChEMBL | CHEMBL3087515 |
